C15H12O2 — CID 138977577
(1aR,2R,7bR)-2-phenyl-2,7b-dihydro-1aH-oxireno[2,3-c]chromene (PubChem CID 138977577) has the molecular formula C15H12O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is (1aR,2R,7bR)-2-phenyl-2,7b-dihydro-1aH-oxireno[2,3-c]chromene.
| Compound Name | (1aR,2R,7bR)-2-phenyl-2,7b-dihydro-1aH-oxireno[2,3-c]chromene |
|---|---|
| PubChem CID | 138977577 |
| Molecular Formula | C15H12O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | (1aR,2R,7bR)-2-phenyl-2,7b-dihydro-1aH-oxireno[2,3-c]chromene |
| SMILES | c1ccc([C@H]2Oc3ccccc3[C@H]3O[C@@H]23)cc1 |
| InChI | InChI=1S/C15H12O2/c1-2-6-10(7-3-1)13-15-14(17-15)11-8-4-5-9-12(11)16-13/h1-9,13-15H/t13-,14-,15+/m1/s1 |
| InChIKey | UDSWFHMHTAAZRX-KFWWJZLASA-N |
| XLogP | 3.26 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|