C17H20O2Si — CID 102036867
trimethyl-[[(2R,3R)-2-phenyl-2,3-dihydro-1-benzofuran-3-yl]oxy]silane (PubChem CID 102036867) has the molecular formula C17H20O2Si and a molecular weight of 284.43 g/mol. Its IUPAC name is trimethyl-[[(2R,3R)-2-phenyl-2,3-dihydro-1-benzofuran-3-yl]oxy]silane.
| Compound Name | trimethyl-[[(2R,3R)-2-phenyl-2,3-dihydro-1-benzofuran-3-yl]oxy]silane |
|---|---|
| PubChem CID | 102036867 |
| Molecular Formula | C17H20O2Si |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | trimethyl-[[(2R,3R)-2-phenyl-2,3-dihydro-1-benzofuran-3-yl]oxy]silane |
| SMILES | C[Si](C)(C)O[C@@H]1c2ccccc2O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H20O2Si/c1-20(2,3)19-17-14-11-7-8-12-15(14)18-16(17)13-9-5-4-6-10-13/h4-12,16-17H,1-3H3/t16-,17-/m1/s1 |
| InChIKey | IQPPITLBJXAPDC-IAGOWNOFSA-N |
| XLogP | 4.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|