C17H28O3Si2 — CID 15660342
trimethyl-[[(2R,3S,4R)-2-phenyl-3-trimethylsilyloxy-3,4-dihydro-2H-pyran-4-yl]oxy]silane (PubChem CID 15660342) has the molecular formula C17H28O3Si2 and a molecular weight of 336.58 g/mol. Its IUPAC name is trimethyl-[[(2R,3S,4R)-2-phenyl-3-trimethylsilyloxy-3,4-dihydro-2H-pyran-4-yl]oxy]silane.
| Compound Name | trimethyl-[[(2R,3S,4R)-2-phenyl-3-trimethylsilyloxy-3,4-dihydro-2H-pyran-4-yl]oxy]silane |
|---|---|
| PubChem CID | 15660342 |
| Molecular Formula | C17H28O3Si2 |
| Molecular Weight | 336.58 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | trimethyl-[[(2R,3S,4R)-2-phenyl-3-trimethylsilyloxy-3,4-dihydro-2H-pyran-4-yl]oxy]silane |
| SMILES | C[Si](C)(C)O[C@H]1[C@@H](c2ccccc2)OC=C[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C17H28O3Si2/c1-21(2,3)19-15-12-13-18-16(14-10-8-7-9-11-14)17(15)20-22(4,5)6/h7-13,15-17H,1-6H3/t15-,16-,17-/m1/s1 |
| InChIKey | VOJZPTZDRHOFOV-BRWVUGGUSA-N |
| XLogP | 4.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.58 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|