About trimethyl-[methyl-[(1S,2R)-2-phenylcyclopropyl]-trimethylsilyloxysilyl]oxysilane
trimethyl-[methyl-[(1S,2R)-2-phenylcyclopropyl]-trimethylsilyloxysilyl]oxysilane (PubChem CID 102422598) has the molecular formula C16H30O2Si3
and a molecular weight of 338.67 g/mol. Its IUPAC name is trimethyl-[methyl-[(1S,2R)-2-phenylcyclopropyl]-trimethylsilyloxysilyl]oxysilane.
Molecular Properties
| Compound Name | trimethyl-[methyl-[(1S,2R)-2-phenylcyclopropyl]-trimethylsilyloxysilyl]oxysilane |
| PubChem CID | 102422598 |
| Molecular Formula | C16H30O2Si3 |
| Molecular Weight | 338.67 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | trimethyl-[methyl-[(1S,2R)-2-phenylcyclopropyl]-trimethylsilyloxysilyl]oxysilane |
| SMILES | C[Si](C)(C)O[Si](C)(O[Si](C)(C)C)[C@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H30O2Si3/c1-19(2,3)17-21(7,18-20(4,5)6)16-13-15(16)14-11-9-8-10-12-14/h8-12,15-16H,13H2,1-7H3/t15-,16+/m1/s1 |
| InChIKey | FFKWUQYHOQNYDY-CVEARBPZSA-N |
| XLogP | 5.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.67 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[methyl-[(1S,2R)-2-phenylcyclopropyl]-trimethylsilyloxysilyl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[methyl-[(1S,2R)-2-phenylcyclopropyl]-trimethylsilyloxysilyl]oxysilane?
The IUPAC name of trimethyl-[methyl-[(1S,2R)-2-phenylcyclopropyl]-trimethylsilyloxysilyl]oxysilane (CID 102422598) is trimethyl-[methyl-[(1S,2R)-2-phenylcyclopropyl]-trimethylsilyloxysilyl]oxysilane.
What is the SMILES notation for trimethyl-[methyl-[(1S,2R)-2-phenylcyclopropyl]-trimethylsilyloxysilyl]oxysilane?
The canonical SMILES for trimethyl-[methyl-[(1S,2R)-2-phenylcyclopropyl]-trimethylsilyloxysilyl]oxysilane is C[Si](C)(C)O[Si](C)(O[Si](C)(C)C)[C@H]1C[C@@H]1c1ccccc1.
What is the InChIKey of trimethyl-[methyl-[(1S,2R)-2-phenylcyclopropyl]-trimethylsilyloxysilyl]oxysilane?
The InChIKey is FFKWUQYHOQNYDY-CVEARBPZSA-N. The full InChI is InChI=1S/C16H30O2Si3/c1-19(2,3)17-21(7,18-20(4,5)6)16-13-15(16)14-11-9-8-10-12-14/h8-12,15-16H,13H2,1-7H3/t15-,16+/m1/s1.
What are the key properties of trimethyl-[methyl-[(1S,2R)-2-phenylcyclopropyl]-trimethylsilyloxysilyl]oxysilane?
trimethyl-[methyl-[(1S,2R)-2-phenylcyclopropyl]-trimethylsilyloxysilyl]oxysilane has a molecular weight of 338.67 g/mol, XLogP of 5.32, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[methyl-[(1S,2R)-2-phenylcyclopropyl]-trimethylsilyloxysilyl]oxysilane is sourced from PubChem (CID 102422598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).