C16H21BrO4Si — CID 10022960
[(2R,4aR,8S,8aR)-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-(bromomethyl)-dimethylsilane (PubChem CID 10022960) has the molecular formula C16H21BrO4Si and a molecular weight of 385.33 g/mol. Its IUPAC name is [(2R,4aR,8S,8aR)-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-(bromomethyl)-dimethylsilane.
| Compound Name | [(2R,4aR,8S,8aR)-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-(bromomethyl)-dimethylsilane |
|---|---|
| PubChem CID | 10022960 |
| Molecular Formula | C16H21BrO4Si |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | [(2R,4aR,8S,8aR)-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-(bromomethyl)-dimethylsilane |
| SMILES | C[Si](C)(CBr)O[C@H]1C=CO[C@@H]2CO[C@@H](c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C16H21BrO4Si/c1-22(2,11-17)21-13-8-9-18-14-10-19-16(20-15(13)14)12-6-4-3-5-7-12/h3-9,13-16H,10-11H2,1-2H3/t13-,14+,15-,16+/m0/s1 |
| InChIKey | WHBMOBBIJKEJQJ-XUWVNRHRSA-N |
| XLogP | 3.54 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|