C39H46O5Si2 — CID 10628040
[(2R,3R,4R)-3,4-bis[[tert-butyl(diphenyl)silyl]oxy]-3,4-dihydro-2H-pyran-2-yl]methyl formate (PubChem CID 10628040) has the molecular formula C39H46O5Si2 and a molecular weight of 650.96 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4-bis[[tert-butyl(diphenyl)silyl]oxy]-3,4-dihydro-2H-pyran-2-yl]methyl formate.
| Compound Name | [(2R,3R,4R)-3,4-bis[[tert-butyl(diphenyl)silyl]oxy]-3,4-dihydro-2H-pyran-2-yl]methyl formate |
|---|---|
| PubChem CID | 10628040 |
| Molecular Formula | C39H46O5Si2 |
| Molecular Weight | 650.96 g/mol |
| Exact Mass | 650.29 |
| IUPAC Name | [(2R,3R,4R)-3,4-bis[[tert-butyl(diphenyl)silyl]oxy]-3,4-dihydro-2H-pyran-2-yl]methyl formate |
| SMILES | CC(C)(C)[Si](O[C@H]1[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C=CO[C@@H]1COC=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H46O5Si2/c1-38(2,3)45(31-19-11-7-12-20-31,32-21-13-8-14-22-32)43-35-27-28-42-36(29-41-30-40)37(35)44-46(39(4,5)6,33-23-15-9-16-24-33)34-25-17-10-18-26-34/h7-28,30,35-37H,29H2,1-6H3/t35-,36-,37+/m1/s1 |
| InChIKey | MVBWZPBZWOJUBN-RQOYOAKWSA-N |
| XLogP | 5.96 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.96 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|