C27H40O3Si2 — CID 102304224
tert-butyl-[[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydrofuran-2-yl]methoxy]-diphenylsilane (PubChem CID 102304224) has the molecular formula C27H40O3Si2 and a molecular weight of 468.79 g/mol. Its IUPAC name is tert-butyl-[[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydrofuran-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydrofuran-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 102304224 |
| Molecular Formula | C27H40O3Si2 |
| Molecular Weight | 468.79 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | tert-butyl-[[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydrofuran-2-yl]methoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C=CO[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H40O3Si2/c1-26(2,3)31(7,8)30-24-19-20-28-25(24)21-29-32(27(4,5)6,22-15-11-9-12-16-22)23-17-13-10-14-18-23/h9-20,24-25H,21H2,1-8H3/t24-,25-/m1/s1 |
| InChIKey | TXETYAGBFKDVJP-JWQCQUIFSA-N |
| XLogP | 5.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.79 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|