C30H42O3Si2 — CID 25229218
tert-butyl-[3-[(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydro-2H-pyran-2-yl]prop-2-ynoxy]-diphenylsilane (PubChem CID 25229218) has the molecular formula C30H42O3Si2 and a molecular weight of 506.84 g/mol. Its IUPAC name is tert-butyl-[3-[(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydro-2H-pyran-2-yl]prop-2-ynoxy]-diphenylsilane.
| Compound Name | tert-butyl-[3-[(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydro-2H-pyran-2-yl]prop-2-ynoxy]-diphenylsilane |
|---|---|
| PubChem CID | 25229218 |
| Molecular Formula | C30H42O3Si2 |
| Molecular Weight | 506.84 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | tert-butyl-[3-[(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydro-2H-pyran-2-yl]prop-2-ynoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C=CO[C@H](C#CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C30H42O3Si2/c1-29(2,3)34(7,8)33-26-21-23-31-25(24-26)16-15-22-32-35(30(4,5)6,27-17-11-9-12-18-27)28-19-13-10-14-20-28/h9-14,17-21,23,25-26H,22,24H2,1-8H3/t25-,26-/m1/s1 |
| InChIKey | TYWYUANUBWUIJW-CLJLJLNGSA-N |
| XLogP | 6.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.84 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|