C28H42O4Si2 — CID 10907211
(3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-2-one (PubChem CID 10907211) has the molecular formula C28H42O4Si2 and a molecular weight of 498.81 g/mol. Its IUPAC name is (3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-2-one.
| Compound Name | (3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-2-one |
|---|---|
| PubChem CID | 10907211 |
| Molecular Formula | C28H42O4Si2 |
| Molecular Weight | 498.81 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | (3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(diphenyl)silyl]oxymethyl]oxan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC1=O |
| InChI | InChI=1S/C28H42O4Si2/c1-27(2,3)33(7,8)32-25-20-19-22(31-26(25)29)21-30-34(28(4,5)6,23-15-11-9-12-16-23)24-17-13-10-14-18-24/h9-18,22,25H,19-21H2,1-8H3/t22-,25+/m0/s1 |
| InChIKey | RVBRLMVERZXERP-WIOPSUGQSA-N |
| XLogP | 5.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.81 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|