C29H34O3SSi — CID 155677398
(2R,3S,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2-methylphenyl)sulfanyl-3,4-dihydro-2H-pyran-3-ol (PubChem CID 155677398) has the molecular formula C29H34O3SSi and a molecular weight of 490.74 g/mol. Its IUPAC name is (2R,3S,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2-methylphenyl)sulfanyl-3,4-dihydro-2H-pyran-3-ol.
| Compound Name | (2R,3S,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2-methylphenyl)sulfanyl-3,4-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 155677398 |
| Molecular Formula | C29H34O3SSi |
| Molecular Weight | 490.74 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | (2R,3S,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2-methylphenyl)sulfanyl-3,4-dihydro-2H-pyran-3-ol |
| SMILES | Cc1ccccc1S[C@H]1C=CO[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]1O |
| InChI | InChI=1S/C29H34O3SSi/c1-22-13-11-12-18-26(22)33-27-19-20-31-25(28(27)30)21-32-34(29(2,3)4,23-14-7-5-8-15-23)24-16-9-6-10-17-24/h5-20,25,27-28,30H,21H2,1-4H3/t25-,27+,28+/m1/s1 |
| InChIKey | RQFSHAXTQSFRNE-PKXQUSJVSA-N |
| XLogP | 5.31 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.74 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|