C54H65O5PSi2 — CID 10056504
(2R,3R,4S,5R)-4-bis(2,4-dimethylphenyl)phosphanyloxy-2,5-bis[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-ol (PubChem CID 10056504) has the molecular formula C54H65O5PSi2 and a molecular weight of 881.26 g/mol. Its IUPAC name is (2R,3R,4S,5R)-4-bis(2,4-dimethylphenyl)phosphanyloxy-2,5-bis[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-ol.
| Compound Name | (2R,3R,4S,5R)-4-bis(2,4-dimethylphenyl)phosphanyloxy-2,5-bis[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-ol |
|---|---|
| PubChem CID | 10056504 |
| Molecular Formula | C54H65O5PSi2 |
| Molecular Weight | 881.26 g/mol |
| Exact Mass | 880.41 |
| IUPAC Name | (2R,3R,4S,5R)-4-bis(2,4-dimethylphenyl)phosphanyloxy-2,5-bis[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-ol |
| SMILES | Cc1ccc(P(O[C@H]2[C@H](O)[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O[C@@H]2CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c2ccc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C54H65O5PSi2/c1-39-31-33-49(41(3)35-39)60(50-34-32-40(2)36-42(50)4)59-52-48(38-57-62(54(8,9)10,45-27-19-13-20-28-45)46-29-21-14-22-30-46)58-47(51(52)55)37-56-61(53(5,6)7,43-23-15-11-16-24-43)44-25-17-12-18-26-44/h11-36,47-48,51-52,55H,37-38H2,1-10H3/t47-,48-,51-,52-/m1/s1 |
| InChIKey | ZVMGYSVELPXAJP-DXGDSEOKSA-N |
| XLogP | 8.93 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.26 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|