C41H52O3Si2 — CID 11308251
(1S,2S,5R,6S)-5,6-bis[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methylcyclohex-3-en-1-ol (PubChem CID 11308251) has the molecular formula C41H52O3Si2 and a molecular weight of 649.04 g/mol. Its IUPAC name is (1S,2S,5R,6S)-5,6-bis[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methylcyclohex-3-en-1-ol.
| Compound Name | (1S,2S,5R,6S)-5,6-bis[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 11308251 |
| Molecular Formula | C41H52O3Si2 |
| Molecular Weight | 649.04 g/mol |
| Exact Mass | 648.35 |
| IUPAC Name | (1S,2S,5R,6S)-5,6-bis[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methylcyclohex-3-en-1-ol |
| SMILES | C[C@H]1C=C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]1O |
| InChI | InChI=1S/C41H52O3Si2/c1-32-28-29-33(30-43-45(40(2,3)4,34-20-12-8-13-21-34)35-22-14-9-15-23-35)38(39(32)42)31-44-46(41(5,6)7,36-24-16-10-17-25-36)37-26-18-11-19-27-37/h8-29,32-33,38-39,42H,30-31H2,1-7H3/t32-,33-,38+,39-/m0/s1 |
| InChIKey | YHQIUCDBLZTKBB-VQDPUQOLSA-N |
| XLogP | 6.94 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.04 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|