C21H26F2O2SSi — CID 10692836
(2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,4-difluorothiolan-3-ol (PubChem CID 10692836) has the molecular formula C21H26F2O2SSi and a molecular weight of 408.59 g/mol. Its IUPAC name is (2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,4-difluorothiolan-3-ol.
| Compound Name | (2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,4-difluorothiolan-3-ol |
|---|---|
| PubChem CID | 10692836 |
| Molecular Formula | C21H26F2O2SSi |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | (2R,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,4-difluorothiolan-3-ol |
| SMILES | CC(C)(C)[Si](OC[C@H]1SCC(F)(F)[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H26F2O2SSi/c1-20(2,3)27(16-10-6-4-7-11-16,17-12-8-5-9-13-17)25-14-18-19(24)21(22,23)15-26-18/h4-13,18-19,24H,14-15H2,1-3H3/t18-,19-/m1/s1 |
| InChIKey | IHRFHUNDQJSXBT-RTBURBONSA-N |
| XLogP | 3.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|