C20H26OSSi — CID 140876888
tert-butyl-[(2-methylthiiran-2-yl)methoxy]-diphenylsilane (PubChem CID 140876888) has the molecular formula C20H26OSSi and a molecular weight of 342.58 g/mol. Its IUPAC name is tert-butyl-[(2-methylthiiran-2-yl)methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2-methylthiiran-2-yl)methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 140876888 |
| Molecular Formula | C20H26OSSi |
| Molecular Weight | 342.58 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | tert-butyl-[(2-methylthiiran-2-yl)methoxy]-diphenylsilane |
| SMILES | CC1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CS1 |
| InChI | InChI=1S/C20H26OSSi/c1-19(2,3)23(17-11-7-5-8-12-17,18-13-9-6-10-14-18)21-15-20(4)16-22-20/h5-14H,15-16H2,1-4H3 |
| InChIKey | YJVUXSGKXOLHON-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.58 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|