C21H27NO3Si — CID 23651169
(4S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyl-1,3-oxazolidin-2-one (PubChem CID 23651169) has the molecular formula C21H27NO3Si and a molecular weight of 369.54 g/mol. Its IUPAC name is (4S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 23651169 |
| Molecular Formula | C21H27NO3Si |
| Molecular Weight | 369.54 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (4S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyl-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)[Si](OC[C@]1(C)COC(=O)N1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27NO3Si/c1-20(2,3)26(17-11-7-5-8-12-17,18-13-9-6-10-14-18)25-16-21(4)15-24-19(23)22-21/h5-14H,15-16H2,1-4H3,(H,22,23)/t21-/m0/s1 |
| InChIKey | YQMZSYUYACOQGK-NRFANRHFSA-N |
| XLogP | 3.06 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|