C25H28O4Si — CID 11327622
6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyl-6,6a-dihydro-1H-cyclopenta[c]furan-3,5-dione (PubChem CID 11327622) has the molecular formula C25H28O4Si and a molecular weight of 420.58 g/mol. Its IUPAC name is 6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyl-6,6a-dihydro-1H-cyclopenta[c]furan-3,5-dione.
| Compound Name | 6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyl-6,6a-dihydro-1H-cyclopenta[c]furan-3,5-dione |
|---|---|
| PubChem CID | 11327622 |
| Molecular Formula | C25H28O4Si |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyl-6,6a-dihydro-1H-cyclopenta[c]furan-3,5-dione |
| SMILES | CC1=C2C(=O)OCC2C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1=O |
| InChI | InChI=1S/C25H28O4Si/c1-17-22-20(15-28-24(22)27)21(23(17)26)16-29-30(25(2,3)4,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,20-21H,15-16H2,1-4H3 |
| InChIKey | HYTYOWPSGOBDDQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|