C24H30O3Si — CID 140892968
5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-5-methylcyclohex-2-en-1-one (PubChem CID 140892968) has the molecular formula C24H30O3Si and a molecular weight of 394.59 g/mol. Its IUPAC name is 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-5-methylcyclohex-2-en-1-one.
| Compound Name | 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-5-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 140892968 |
| Molecular Formula | C24H30O3Si |
| Molecular Weight | 394.59 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-5-methylcyclohex-2-en-1-one |
| SMILES | CC1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC(=O)C=C(O)C1 |
| InChI | InChI=1S/C24H30O3Si/c1-23(2,3)28(21-11-7-5-8-12-21,22-13-9-6-10-14-22)27-18-24(4)16-19(25)15-20(26)17-24/h5-15,25H,16-18H2,1-4H3 |
| InChIKey | MJATUSDWAQSZKX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|