C22H26Cl2O3Si — CID 11362619
(5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(dichloromethyl)oxolan-2-one (PubChem CID 11362619) has the molecular formula C22H26Cl2O3Si and a molecular weight of 437.44 g/mol. Its IUPAC name is (5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(dichloromethyl)oxolan-2-one.
| Compound Name | (5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(dichloromethyl)oxolan-2-one |
|---|---|
| PubChem CID | 11362619 |
| Molecular Formula | C22H26Cl2O3Si |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | (5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(dichloromethyl)oxolan-2-one |
| SMILES | CC(C)(C)[Si](OC[C@]1(C(Cl)Cl)CCC(=O)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H26Cl2O3Si/c1-21(2,3)28(17-10-6-4-7-11-17,18-12-8-5-9-13-18)26-16-22(20(23)24)15-14-19(25)27-22/h4-13,20H,14-16H2,1-3H3/t22-/m0/s1 |
| InChIKey | SSDDTDKVJHXYLD-QFIPXVFZSA-N |
| XLogP | 4.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|