C28H33NO3Si — CID 11733221
1-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxypyrrolidin-2-one (PubChem CID 11733221) has the molecular formula C28H33NO3Si and a molecular weight of 459.66 g/mol. Its IUPAC name is 1-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxypyrrolidin-2-one.
| Compound Name | 1-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxypyrrolidin-2-one |
|---|---|
| PubChem CID | 11733221 |
| Molecular Formula | C28H33NO3Si |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 1-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxypyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](OCC1(O)CCC(=O)N1Cc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H33NO3Si/c1-27(2,3)33(24-15-9-5-10-16-24,25-17-11-6-12-18-25)32-22-28(31)20-19-26(30)29(28)21-23-13-7-4-8-14-23/h4-18,31H,19-22H2,1-3H3 |
| InChIKey | PJGVDPZHASIRFZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|