C22H26O2Si — CID 141485645
tert-butyl-[(3-ethynyloxetan-3-yl)methoxy]-diphenylsilane (PubChem CID 141485645) has the molecular formula C22H26O2Si and a molecular weight of 350.53 g/mol. Its IUPAC name is tert-butyl-[(3-ethynyloxetan-3-yl)methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(3-ethynyloxetan-3-yl)methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 141485645 |
| Molecular Formula | C22H26O2Si |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | tert-butyl-[(3-ethynyloxetan-3-yl)methoxy]-diphenylsilane |
| SMILES | C#CC1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)COC1 |
| InChI | InChI=1S/C22H26O2Si/c1-5-22(16-23-17-22)18-24-25(21(2,3)4,19-12-8-6-9-13-19)20-14-10-7-11-15-20/h1,6-15H,16-18H2,2-4H3 |
| InChIKey | OFANKZZMZLVIOP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|