C23H32O3Si — CID 11090300
(2S)-4-[tert-butyl(diphenyl)silyl]oxy-1-[(2S)-2-methyloxiran-2-yl]butan-2-ol (PubChem CID 11090300) has the molecular formula C23H32O3Si and a molecular weight of 384.59 g/mol. Its IUPAC name is (2S)-4-[tert-butyl(diphenyl)silyl]oxy-1-[(2S)-2-methyloxiran-2-yl]butan-2-ol.
| Compound Name | (2S)-4-[tert-butyl(diphenyl)silyl]oxy-1-[(2S)-2-methyloxiran-2-yl]butan-2-ol |
|---|---|
| PubChem CID | 11090300 |
| Molecular Formula | C23H32O3Si |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | (2S)-4-[tert-butyl(diphenyl)silyl]oxy-1-[(2S)-2-methyloxiran-2-yl]butan-2-ol |
| SMILES | CC(C)(C)[Si](OCC[C@H](O)C[C@@]1(C)CO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H32O3Si/c1-22(2,3)27(20-11-7-5-8-12-20,21-13-9-6-10-14-21)26-16-15-19(24)17-23(4)18-25-23/h5-14,19,24H,15-18H2,1-4H3/t19-,23-/m0/s1 |
| InChIKey | HYVVGJNKTMTWQD-CVDCTZTESA-N |
| XLogP | 3.49 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|