C26H36O3Si — CID 10002494
(1R)-5-[tert-butyl(diphenyl)silyl]oxy-1-[(5R)-5-methyl-2H-furan-5-yl]pentan-1-ol (PubChem CID 10002494) has the molecular formula C26H36O3Si and a molecular weight of 424.66 g/mol. Its IUPAC name is (1R)-5-[tert-butyl(diphenyl)silyl]oxy-1-[(5R)-5-methyl-2H-furan-5-yl]pentan-1-ol.
| Compound Name | (1R)-5-[tert-butyl(diphenyl)silyl]oxy-1-[(5R)-5-methyl-2H-furan-5-yl]pentan-1-ol |
|---|---|
| PubChem CID | 10002494 |
| Molecular Formula | C26H36O3Si |
| Molecular Weight | 424.66 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | (1R)-5-[tert-butyl(diphenyl)silyl]oxy-1-[(5R)-5-methyl-2H-furan-5-yl]pentan-1-ol |
| SMILES | CC(C)(C)[Si](OCCCC[C@@H](O)[C@@]1(C)C=CCO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H36O3Si/c1-25(2,3)30(22-14-7-5-8-15-22,23-16-9-6-10-17-23)29-21-12-11-18-24(27)26(4)19-13-20-28-26/h5-10,13-17,19,24,27H,11-12,18,20-21H2,1-4H3/t24-,26-/m1/s1 |
| InChIKey | JTYYBFGEBKPSDR-AOYPEHQESA-N |
| XLogP | 4.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.66 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|