C30H43Cl3O2Si — CID 46915467
(E,4R,5S,6S,7R)-14-[tert-butyl(diphenyl)silyl]oxy-5,6,7-trichlorotetradec-2-en-4-ol (PubChem CID 46915467) has the molecular formula C30H43Cl3O2Si and a molecular weight of 570.12 g/mol. Its IUPAC name is (E,4R,5S,6S,7R)-14-[tert-butyl(diphenyl)silyl]oxy-5,6,7-trichlorotetradec-2-en-4-ol.
| Compound Name | (E,4R,5S,6S,7R)-14-[tert-butyl(diphenyl)silyl]oxy-5,6,7-trichlorotetradec-2-en-4-ol |
|---|---|
| PubChem CID | 46915467 |
| Molecular Formula | C30H43Cl3O2Si |
| Molecular Weight | 570.12 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | (E,4R,5S,6S,7R)-14-[tert-butyl(diphenyl)silyl]oxy-5,6,7-trichlorotetradec-2-en-4-ol |
| SMILES | C/C=C/[C@@H](O)[C@H](Cl)[C@@H](Cl)[C@H](Cl)CCCCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H43Cl3O2Si/c1-5-17-27(34)29(33)28(32)26(31)22-15-7-6-8-16-23-35-36(30(2,3)4,24-18-11-9-12-19-24)25-20-13-10-14-21-25/h5,9-14,17-21,26-29,34H,6-8,15-16,22-23H2,1-4H3/b17-5+/t26-,27-,28+,29+/m1/s1 |
| InChIKey | AZIJDTAOLLFNQX-JRJIFQOASA-N |
| XLogP | 7.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.12 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|