C32H42Cl8O3Si — CID 46915081
[(2S,3R,4R,5S,6S,7R)-14-[tert-butyl(diphenyl)silyl]oxy-2,3,5,6,7-pentachlorotetradecan-4-yl] 2,2,2-trichloroacetate (PubChem CID 46915081) has the molecular formula C32H42Cl8O3Si and a molecular weight of 786.40 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6S,7R)-14-[tert-butyl(diphenyl)silyl]oxy-2,3,5,6,7-pentachlorotetradecan-4-yl] 2,2,2-trichloroacetate.
| Compound Name | [(2S,3R,4R,5S,6S,7R)-14-[tert-butyl(diphenyl)silyl]oxy-2,3,5,6,7-pentachlorotetradecan-4-yl] 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 46915081 |
| Molecular Formula | C32H42Cl8O3Si |
| Molecular Weight | 786.40 g/mol |
| Exact Mass | 782.04 |
| IUPAC Name | [(2S,3R,4R,5S,6S,7R)-14-[tert-butyl(diphenyl)silyl]oxy-2,3,5,6,7-pentachlorotetradecan-4-yl] 2,2,2-trichloroacetate |
| SMILES | C[C@H](Cl)[C@H](Cl)[C@@H](OC(=O)C(Cl)(Cl)Cl)[C@H](Cl)[C@@H](Cl)[C@H](Cl)CCCCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H42Cl8O3Si/c1-22(33)26(35)29(43-30(41)32(38,39)40)28(37)27(36)25(34)20-14-6-5-7-15-21-42-44(31(2,3)4,23-16-10-8-11-17-23)24-18-12-9-13-19-24/h8-13,16-19,22,25-29H,5-7,14-15,20-21H2,1-4H3/t22-,25+,26-,27-,28+,29+/m0/s1 |
| InChIKey | ZMLVOAMOANWRQC-MGAQRHNNSA-N |
| XLogP | 10.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.40 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|