C21H29NO5SSi — CID 177454012
(4S,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyl-2,2-dioxooxathiazinan-5-ol (PubChem CID 177454012) has the molecular formula C21H29NO5SSi and a molecular weight of 435.62 g/mol. Its IUPAC name is (4S,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyl-2,2-dioxooxathiazinan-5-ol.
| Compound Name | (4S,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyl-2,2-dioxooxathiazinan-5-ol |
|---|---|
| PubChem CID | 177454012 |
| Molecular Formula | C21H29NO5SSi |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | (4S,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methyl-2,2-dioxooxathiazinan-5-ol |
| SMILES | CC(C)(C)[Si](OC[C@]1(C)NS(=O)(=O)OC[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H29NO5SSi/c1-20(2,3)29(17-11-7-5-8-12-17,18-13-9-6-10-14-18)27-16-21(4)19(23)15-26-28(24,25)22-21/h5-14,19,22-23H,15-16H2,1-4H3/t19-,21-/m0/s1 |
| InChIKey | PTJOUPCWTLVOFR-FPOVZHCZSA-N |
| XLogP | 1.55 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|