C30H44O4Si2 — CID 56655331
[(1R,3R,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[tert-butyl(diphenyl)silyl]oxy-2-methylidenecyclopentyl] formate (PubChem CID 56655331) has the molecular formula C30H44O4Si2 and a molecular weight of 524.85 g/mol. Its IUPAC name is [(1R,3R,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[tert-butyl(diphenyl)silyl]oxy-2-methylidenecyclopentyl] formate.
| Compound Name | [(1R,3R,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[tert-butyl(diphenyl)silyl]oxy-2-methylidenecyclopentyl] formate |
|---|---|
| PubChem CID | 56655331 |
| Molecular Formula | C30H44O4Si2 |
| Molecular Weight | 524.85 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | [(1R,3R,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[tert-butyl(diphenyl)silyl]oxy-2-methylidenecyclopentyl] formate |
| SMILES | C=C1[C@H](OC=O)C[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H44O4Si2/c1-23-26(21-33-35(8,9)29(2,3)4)28(20-27(23)32-22-31)34-36(30(5,6)7,24-16-12-10-13-17-24)25-18-14-11-15-19-25/h10-19,22,26-28H,1,20-21H2,2-9H3/t26-,27+,28+/m0/s1 |
| InChIKey | CWTOBFFTCTUWIT-UPRLRBBYSA-N |
| XLogP | 6.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.85 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|