C30H46O3Si2 — CID 24854156
(1R,2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclopentane-1-carbaldehyde (PubChem CID 24854156) has the molecular formula C30H46O3Si2 and a molecular weight of 510.87 g/mol. Its IUPAC name is (1R,2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclopentane-1-carbaldehyde.
| Compound Name | (1R,2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 24854156 |
| Molecular Formula | C30H46O3Si2 |
| Molecular Weight | 510.87 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | (1R,2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclopentane-1-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](C=O)C1 |
| InChI | InChI=1S/C30H46O3Si2/c1-29(2,3)34(7,8)33-26-21-24(25(22-26)23-31)19-20-32-35(30(4,5)6,27-15-11-9-12-16-27)28-17-13-10-14-18-28/h9-18,23-26H,19-22H2,1-8H3/t24-,25+,26+/m1/s1 |
| InChIKey | KOAHYFHQLOOUQZ-ZNZIZOMTSA-N |
| XLogP | 6.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.87 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|