C30H34O2Si — CID 11155267
(1S,2R)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-phenylcyclopent-3-ene-1-carbaldehyde (PubChem CID 11155267) has the molecular formula C30H34O2Si and a molecular weight of 454.69 g/mol. Its IUPAC name is (1S,2R)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-phenylcyclopent-3-ene-1-carbaldehyde.
| Compound Name | (1S,2R)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-phenylcyclopent-3-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 11155267 |
| Molecular Formula | C30H34O2Si |
| Molecular Weight | 454.69 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | (1S,2R)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-phenylcyclopent-3-ene-1-carbaldehyde |
| SMILES | CC(C)(C)[Si](OCC[C@@H]1C=C(c2ccccc2)C[C@@H]1C=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H34O2Si/c1-30(2,3)33(28-15-9-5-10-16-28,29-17-11-6-12-18-29)32-20-19-25-21-26(22-27(25)23-31)24-13-7-4-8-14-24/h4-18,21,23,25,27H,19-20,22H2,1-3H3/t25-,27-/m1/s1 |
| InChIKey | WYVGYAGHPRNUND-XNMGPUDCSA-N |
| XLogP | 5.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.69 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|