C33H40O4Si — CID 101412798
2-[(1R,2S,5R)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-[(4-methoxyphenyl)methoxy]cyclopent-3-en-1-yl]acetaldehyde (PubChem CID 101412798) has the molecular formula C33H40O4Si and a molecular weight of 528.77 g/mol. Its IUPAC name is 2-[(1R,2S,5R)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-[(4-methoxyphenyl)methoxy]cyclopent-3-en-1-yl]acetaldehyde.
| Compound Name | 2-[(1R,2S,5R)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-[(4-methoxyphenyl)methoxy]cyclopent-3-en-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 101412798 |
| Molecular Formula | C33H40O4Si |
| Molecular Weight | 528.77 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | 2-[(1R,2S,5R)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-5-[(4-methoxyphenyl)methoxy]cyclopent-3-en-1-yl]acetaldehyde |
| SMILES | COc1ccc(CO[C@@H]2C=C[C@H](CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H]2CC=O)cc1 |
| InChI | InChI=1S/C33H40O4Si/c1-33(2,3)38(29-11-7-5-8-12-29,30-13-9-6-10-14-30)37-24-22-27-17-20-32(31(27)21-23-34)36-25-26-15-18-28(35-4)19-16-26/h5-20,23,27,31-32H,21-22,24-25H2,1-4H3/t27-,31-,32-/m1/s1 |
| InChIKey | CVGPETJHQXRGQG-MBYALERHSA-N |
| XLogP | 5.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.77 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|