C36H39NO5Si — CID 102282449
(3S,4S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(4-methoxyphenyl)methyl]-4-phenylmethoxypyrrolidine-2,5-dione (PubChem CID 102282449) has the molecular formula C36H39NO5Si and a molecular weight of 593.80 g/mol. Its IUPAC name is (3S,4S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(4-methoxyphenyl)methyl]-4-phenylmethoxypyrrolidine-2,5-dione.
| Compound Name | (3S,4S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(4-methoxyphenyl)methyl]-4-phenylmethoxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 102282449 |
| Molecular Formula | C36H39NO5Si |
| Molecular Weight | 593.80 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | (3S,4S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(4-methoxyphenyl)methyl]-4-phenylmethoxypyrrolidine-2,5-dione |
| SMILES | COc1ccc(CN2C(=O)[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H](OCc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C36H39NO5Si/c1-36(2,3)43(30-16-10-6-11-17-30,31-18-12-7-13-19-31)42-26-32-33(41-25-28-14-8-5-9-15-28)35(39)37(34(32)38)24-27-20-22-29(40-4)23-21-27/h5-23,32-33H,24-26H2,1-4H3/t32-,33-/m0/s1 |
| InChIKey | HDFASHLADMTIQB-LQJZCPKCSA-N |
| XLogP | 5.34 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.80 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|