C34H52O3Si2 — CID 11082324
2-[(1S,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6-methylidenecyclohexyl]acetaldehyde (PubChem CID 11082324) has the molecular formula C34H52O3Si2 and a molecular weight of 564.96 g/mol. Its IUPAC name is 2-[(1S,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6-methylidenecyclohexyl]acetaldehyde.
| Compound Name | 2-[(1S,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6-methylidenecyclohexyl]acetaldehyde |
|---|---|
| PubChem CID | 11082324 |
| Molecular Formula | C34H52O3Si2 |
| Molecular Weight | 564.96 g/mol |
| Exact Mass | 564.35 |
| IUPAC Name | 2-[(1S,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6-methylidenecyclohexyl]acetaldehyde |
| SMILES | C=C1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(C)(C)[C@H]1CC=O |
| InChI | InChI=1S/C34H52O3Si2/c1-26-24-31(37-38(10,11)32(2,3)4)30(34(8,9)29(26)22-23-35)25-36-39(33(5,6)7,27-18-14-12-15-19-27)28-20-16-13-17-21-28/h12-21,23,29-31H,1,22,24-25H2,2-11H3/t29-,30+,31-/m0/s1 |
| InChIKey | ZGGNIDAEDMQSLW-YPKYBTACSA-N |
| XLogP | 7.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.96 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|