C23H30O3Si — CID 99865831
(3R,4S)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,4-dihydro-2H-pyran-4-ol (PubChem CID 99865831) has the molecular formula C23H30O3Si and a molecular weight of 382.58 g/mol. Its IUPAC name is (3R,4S)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,4-dihydro-2H-pyran-4-ol.
| Compound Name | (3R,4S)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,4-dihydro-2H-pyran-4-ol |
|---|---|
| PubChem CID | 99865831 |
| Molecular Formula | C23H30O3Si |
| Molecular Weight | 382.58 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (3R,4S)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,4-dihydro-2H-pyran-4-ol |
| SMILES | CC(C)(C)[Si](OCC[C@@H]1COC=C[C@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H30O3Si/c1-23(2,3)27(20-10-6-4-7-11-20,21-12-8-5-9-13-21)26-17-14-19-18-25-16-15-22(19)24/h4-13,15-16,19,22,24H,14,17-18H2,1-3H3/t19-,22-/m1/s1 |
| InChIKey | LZDWRJRTXSUEKQ-DENIHFKCSA-N |
| XLogP | 3.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.58 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|