C24H32O5Si — CID 160626165
(3R,3aR,6S,6aR)-6-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 160626165) has the molecular formula C24H32O5Si and a molecular weight of 428.60 g/mol. Its IUPAC name is (3R,3aR,6S,6aR)-6-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6S,6aR)-6-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 160626165 |
| Molecular Formula | C24H32O5Si |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | (3R,3aR,6S,6aR)-6-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | CC(C)(C)[Si](OCCO[C@H]1CO[C@H]2[C@@H]1OC[C@H]2O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H32O5Si/c1-24(2,3)30(18-10-6-4-7-11-18,19-12-8-5-9-13-19)29-15-14-26-21-17-28-22-20(25)16-27-23(21)22/h4-13,20-23,25H,14-17H2,1-3H3/t20-,21+,22-,23-/m1/s1 |
| InChIKey | PTWYTAKLIAHZOB-KAOXLYBCSA-N |
| XLogP | 2.11 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|