C22H22O2Si — CID 102036868
dimethyl-phenyl-[[(2R,3R)-2-phenyl-2,3-dihydro-1-benzofuran-3-yl]oxy]silane (PubChem CID 102036868) has the molecular formula C22H22O2Si and a molecular weight of 346.50 g/mol. Its IUPAC name is dimethyl-phenyl-[[(2R,3R)-2-phenyl-2,3-dihydro-1-benzofuran-3-yl]oxy]silane.
| Compound Name | dimethyl-phenyl-[[(2R,3R)-2-phenyl-2,3-dihydro-1-benzofuran-3-yl]oxy]silane |
|---|---|
| PubChem CID | 102036868 |
| Molecular Formula | C22H22O2Si |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | dimethyl-phenyl-[[(2R,3R)-2-phenyl-2,3-dihydro-1-benzofuran-3-yl]oxy]silane |
| SMILES | C[Si](C)(O[C@@H]1c2ccccc2O[C@@H]1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H22O2Si/c1-25(2,18-13-7-4-8-14-18)24-22-19-15-9-10-16-20(19)23-21(22)17-11-5-3-6-12-17/h3-16,21-22H,1-2H3/t21-,22-/m1/s1 |
| InChIKey | BZWBJQWAUWHBAB-FGZHOGPDSA-N |
| XLogP | 4.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|