C13H20O2Si — CID 10633593
cis-(1R,2S)-2-[dimethyl(phenyl)silyl]oxycyclopentan-1-ol (PubChem CID 10633593) has the molecular formula C13H20O2Si and a molecular weight of 236.39 g/mol. Its IUPAC name is cis-(1R,2S)-2-[dimethyl(phenyl)silyl]oxycyclopentan-1-ol.
| Compound Name | cis-(1R,2S)-2-[dimethyl(phenyl)silyl]oxycyclopentan-1-ol |
|---|---|
| PubChem CID | 10633593 |
| Molecular Formula | C13H20O2Si |
| Molecular Weight | 236.39 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | cis-(1R,2S)-2-[dimethyl(phenyl)silyl]oxycyclopentan-1-ol |
| SMILES | C[Si](C)(O[C@H]1CCC[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C13H20O2Si/c1-16(2,11-7-4-3-5-8-11)15-13-10-6-9-12(13)14/h3-5,7-8,12-14H,6,9-10H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | SSPBFVGRECNCPZ-OLZOCXBDSA-N |
| XLogP | 2.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|