C15H22O4Si — CID 71335404
acetic acid;4-[dimethyl(phenyl)silyl]oxycyclopent-2-en-1-ol (PubChem CID 71335404) has the molecular formula C15H22O4Si and a molecular weight of 294.42 g/mol. Its IUPAC name is acetic acid;4-[dimethyl(phenyl)silyl]oxycyclopent-2-en-1-ol.
| Compound Name | acetic acid;4-[dimethyl(phenyl)silyl]oxycyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 71335404 |
| Molecular Formula | C15H22O4Si |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | acetic acid;4-[dimethyl(phenyl)silyl]oxycyclopent-2-en-1-ol |
| SMILES | CC(=O)O.C[Si](C)(OC1C=CC(O)C1)c1ccccc1 |
| InChI | InChI=1S/C13H18O2Si.C2H4O2/c1-16(2,13-6-4-3-5-7-13)15-12-9-8-11(14)10-12;1-2(3)4/h3-9,11-12,14H,10H2,1-2H3;1H3,(H,3,4) |
| InChIKey | IFYUGPJCJNYWDU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|