C24H22O2 — CID 11121433
(1R,4R)-4-trityloxycyclopent-2-en-1-ol (PubChem CID 11121433) has the molecular formula C24H22O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is (1R,4R)-4-trityloxycyclopent-2-en-1-ol.
| Compound Name | (1R,4R)-4-trityloxycyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 11121433 |
| Molecular Formula | C24H22O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (1R,4R)-4-trityloxycyclopent-2-en-1-ol |
| SMILES | O[C@H]1C=C[C@H](OC(c2ccccc2)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C24H22O2/c25-22-16-17-23(18-22)26-24(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-17,22-23,25H,18H2/t22-,23-/m0/s1 |
| InChIKey | SQEUQZGEWFRAMB-GOTSBHOMSA-N |
| XLogP | 4.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|