C31H31NO2 — CID 11561465
(3R,5R)-1-benzyl-5-trityloxypiperidin-3-ol (PubChem CID 11561465) has the molecular formula C31H31NO2 and a molecular weight of 449.59 g/mol. Its IUPAC name is (3R,5R)-1-benzyl-5-trityloxypiperidin-3-ol.
| Compound Name | (3R,5R)-1-benzyl-5-trityloxypiperidin-3-ol |
|---|---|
| PubChem CID | 11561465 |
| Molecular Formula | C31H31NO2 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | (3R,5R)-1-benzyl-5-trityloxypiperidin-3-ol |
| SMILES | O[C@@H]1C[C@@H](OC(c2ccccc2)(c2ccccc2)c2ccccc2)CN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C31H31NO2/c33-29-21-30(24-32(23-29)22-25-13-5-1-6-14-25)34-31(26-15-7-2-8-16-26,27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-20,29-30,33H,21-24H2/t29-,30-/m1/s1 |
| InChIKey | UNHWSGAUGSAISU-LOYHVIPDSA-N |
| XLogP | 5.63 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|