C24H25NO3 — CID 166803425
(3S,4R,5R)-3-amino-5-trityloxyoxan-4-ol (PubChem CID 166803425) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is (3S,4R,5R)-3-amino-5-trityloxyoxan-4-ol.
| Compound Name | (3S,4R,5R)-3-amino-5-trityloxyoxan-4-ol |
|---|---|
| PubChem CID | 166803425 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (3S,4R,5R)-3-amino-5-trityloxyoxan-4-ol |
| SMILES | N[C@H]1COC[C@@H](OC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C24H25NO3/c25-21-16-27-17-22(23(21)26)28-24(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,21-23,26H,16-17,25H2/t21-,22+,23+/m0/s1 |
| InChIKey | SBVRQQYGZHQEAX-YTFSRNRJSA-N |
| XLogP | 3.08 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|