C25H24O2 — CID 88896051
(2R,6R)-2-trityloxy-7-oxabicyclo[4.1.0]heptane (PubChem CID 88896051) has the molecular formula C25H24O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is (2R,6R)-2-trityloxy-7-oxabicyclo[4.1.0]heptane.
| Compound Name | (2R,6R)-2-trityloxy-7-oxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 88896051 |
| Molecular Formula | C25H24O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (2R,6R)-2-trityloxy-7-oxabicyclo[4.1.0]heptane |
| SMILES | c1ccc(C(O[C@@H]2CCC[C@H]3OC32)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24O2/c1-4-11-19(12-5-1)25(20-13-6-2-7-14-20,21-15-8-3-9-16-21)27-23-18-10-17-22-24(23)26-22/h1-9,11-16,22-24H,10,17-18H2/t22-,23-,24?/m1/s1 |
| InChIKey | BQLFQOARPLPXCA-YOQGVNIDSA-N |
| XLogP | 5.32 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|