C20H22O5 — CID 16727797
(1R,2S,5R,6S)-2,5-bis(phenylmethoxymethyl)-3,4,7-trioxabicyclo[4.1.0]heptane (PubChem CID 16727797) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is (1R,2S,5R,6S)-2,5-bis(phenylmethoxymethyl)-3,4,7-trioxabicyclo[4.1.0]heptane.
| Compound Name | (1R,2S,5R,6S)-2,5-bis(phenylmethoxymethyl)-3,4,7-trioxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 16727797 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (1R,2S,5R,6S)-2,5-bis(phenylmethoxymethyl)-3,4,7-trioxabicyclo[4.1.0]heptane |
| SMILES | c1ccc(COC[C@@H]2OO[C@H](COCc3ccccc3)[C@H]3O[C@H]32)cc1 |
| InChI | InChI=1S/C20H22O5/c1-3-7-15(8-4-1)11-21-13-17-19-20(23-19)18(25-24-17)14-22-12-16-9-5-2-6-10-16/h1-10,17-20H,11-14H2/t17-,18+,19-,20+ |
| InChIKey | QLSKCMMUNUTSHA-FGYAAKKASA-N |
| XLogP | 2.89 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|