About (2S)-2-trityloxyoxirane
(2S)-2-trityloxyoxirane (PubChem CID 142635645) has the molecular formula C21H18O2
and a molecular weight of 302.37 g/mol. Its IUPAC name is (2S)-2-trityloxyoxirane.
Molecular Properties
| Compound Name | (2S)-2-trityloxyoxirane |
| PubChem CID | 142635645 |
| Molecular Formula | C21H18O2 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (2S)-2-trityloxyoxirane |
| SMILES | c1ccc(C(O[C@H]2CO2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H18O2/c1-4-10-17(11-5-1)21(23-20-16-22-20,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15,20H,16H2/t20-/m0/s1 |
| InChIKey | LPAIANAAMZWGDJ-FQEVSTJZSA-N |
| XLogP | 4.35 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-trityloxyoxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-trityloxyoxirane?
The IUPAC name of (2S)-2-trityloxyoxirane (CID 142635645) is (2S)-2-trityloxyoxirane.
What is the SMILES notation for (2S)-2-trityloxyoxirane?
The canonical SMILES for (2S)-2-trityloxyoxirane is c1ccc(C(O[C@H]2CO2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of (2S)-2-trityloxyoxirane?
The InChIKey is LPAIANAAMZWGDJ-FQEVSTJZSA-N. The full InChI is InChI=1S/C21H18O2/c1-4-10-17(11-5-1)21(23-20-16-22-20,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15,20H,16H2/t20-/m0/s1.
What are the key properties of (2S)-2-trityloxyoxirane?
(2S)-2-trityloxyoxirane has a molecular weight of 302.37 g/mol, XLogP of 4.35, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-trityloxyoxirane is sourced from PubChem (CID 142635645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).