C25H24O2 — CID 10021190
(1S,4R)-4-(trityloxymethyl)cyclopent-2-en-1-ol (PubChem CID 10021190) has the molecular formula C25H24O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is (1S,4R)-4-(trityloxymethyl)cyclopent-2-en-1-ol.
| Compound Name | (1S,4R)-4-(trityloxymethyl)cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 10021190 |
| Molecular Formula | C25H24O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (1S,4R)-4-(trityloxymethyl)cyclopent-2-en-1-ol |
| SMILES | O[C@@H]1C=C[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C25H24O2/c26-24-17-16-20(18-24)19-27-25(21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-17,20,24,26H,18-19H2/t20-,24+/m0/s1 |
| InChIKey | BNAPSUCFSUSJJW-GBXCKJPGSA-N |
| XLogP | 4.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|