C14H22OSi — CID 101053529
cis-(1R,3S)-3-[dimethyl(phenyl)silyl]cyclohexan-1-ol (PubChem CID 101053529) has the molecular formula C14H22OSi and a molecular weight of 234.42 g/mol. Its IUPAC name is cis-(1R,3S)-3-[dimethyl(phenyl)silyl]cyclohexan-1-ol.
| Compound Name | cis-(1R,3S)-3-[dimethyl(phenyl)silyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 101053529 |
| Molecular Formula | C14H22OSi |
| Molecular Weight | 234.42 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | cis-(1R,3S)-3-[dimethyl(phenyl)silyl]cyclohexan-1-ol |
| SMILES | C[Si](C)(c1ccccc1)[C@H]1CCC[C@@H](O)C1 |
| InChI | InChI=1S/C14H22OSi/c1-16(2,13-8-4-3-5-9-13)14-10-6-7-12(15)11-14/h3-5,8-9,12,14-15H,6-7,10-11H2,1-2H3/t12-,14+/m1/s1 |
| InChIKey | BGFWSEDTPUXUEJ-OCCSQVGLSA-N |
| XLogP | 2.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|