C12H16OS — CID 11117279
cis-(1S,3R)-3-phenylsulfanylcyclohexan-1-ol (PubChem CID 11117279) has the molecular formula C12H16OS and a molecular weight of 208.33 g/mol. Its IUPAC name is cis-(1S,3R)-3-phenylsulfanylcyclohexan-1-ol.
| Compound Name | cis-(1S,3R)-3-phenylsulfanylcyclohexan-1-ol |
|---|---|
| PubChem CID | 11117279 |
| Molecular Formula | C12H16OS |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | cis-(1S,3R)-3-phenylsulfanylcyclohexan-1-ol |
| SMILES | O[C@H]1CCC[C@@H](Sc2ccccc2)C1 |
| InChI | InChI=1S/C12H16OS/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-3,6-7,10,12-13H,4-5,8-9H2/t10-,12+/m0/s1 |
| InChIKey | BGXAQIXMMBOYTH-CMPLNLGQSA-N |
| XLogP | 3.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |