C14H18O3S — CID 101098846
(6R,8R)-6-phenylsulfanyl-1,4-dioxaspiro[4.5]decan-8-ol (PubChem CID 101098846) has the molecular formula C14H18O3S and a molecular weight of 266.36 g/mol. Its IUPAC name is (6R,8R)-6-phenylsulfanyl-1,4-dioxaspiro[4.5]decan-8-ol.
| Compound Name | (6R,8R)-6-phenylsulfanyl-1,4-dioxaspiro[4.5]decan-8-ol |
|---|---|
| PubChem CID | 101098846 |
| Molecular Formula | C14H18O3S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | (6R,8R)-6-phenylsulfanyl-1,4-dioxaspiro[4.5]decan-8-ol |
| SMILES | O[C@@H]1CCC2(OCCO2)[C@H](Sc2ccccc2)C1 |
| InChI | InChI=1S/C14H18O3S/c15-11-6-7-14(16-8-9-17-14)13(10-11)18-12-4-2-1-3-5-12/h1-5,11,13,15H,6-10H2/t11-,13-/m1/s1 |
| InChIKey | GXELGLRLIKODHC-DGCLKSJQSA-N |
| XLogP | 2.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |