C16H26OSi — CID 71423247
trans-(1R,3R)-3-[dimethyl(phenyl)silyl]-4,4-dimethylcyclohexan-1-ol (PubChem CID 71423247) has the molecular formula C16H26OSi and a molecular weight of 262.47 g/mol. Its IUPAC name is trans-(1R,3R)-3-[dimethyl(phenyl)silyl]-4,4-dimethylcyclohexan-1-ol.
| Compound Name | trans-(1R,3R)-3-[dimethyl(phenyl)silyl]-4,4-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 71423247 |
| Molecular Formula | C16H26OSi |
| Molecular Weight | 262.47 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | trans-(1R,3R)-3-[dimethyl(phenyl)silyl]-4,4-dimethylcyclohexan-1-ol |
| SMILES | CC1(C)CC[C@@H](O)C[C@H]1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C16H26OSi/c1-16(2)11-10-13(17)12-15(16)18(3,4)14-8-6-5-7-9-14/h5-9,13,15,17H,10-12H2,1-4H3/t13-,15-/m1/s1 |
| InChIKey | RUOMZVZTFASEJC-UKRRQHHQSA-N |
| XLogP | 3.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|