C22H34O3Si — CID 23229017
(1R,6S,7R,9R)-7-[dimethyl(phenyl)silyl]-3,3-dimethyl-2,4-dioxatricyclo[4.4.4.01,6]tetradecan-9-ol (PubChem CID 23229017) has the molecular formula C22H34O3Si and a molecular weight of 374.60 g/mol. Its IUPAC name is (1R,6S,7R,9R)-7-[dimethyl(phenyl)silyl]-3,3-dimethyl-2,4-dioxatricyclo[4.4.4.01,6]tetradecan-9-ol.
| Compound Name | (1R,6S,7R,9R)-7-[dimethyl(phenyl)silyl]-3,3-dimethyl-2,4-dioxatricyclo[4.4.4.01,6]tetradecan-9-ol |
|---|---|
| PubChem CID | 23229017 |
| Molecular Formula | C22H34O3Si |
| Molecular Weight | 374.60 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | (1R,6S,7R,9R)-7-[dimethyl(phenyl)silyl]-3,3-dimethyl-2,4-dioxatricyclo[4.4.4.01,6]tetradecan-9-ol |
| SMILES | CC1(C)OC[C@@]23CCCC[C@]2(C[C@@H](O)C[C@H]3[Si](C)(C)c2ccccc2)O1 |
| InChI | InChI=1S/C22H34O3Si/c1-20(2)24-16-21-12-8-9-13-22(21,25-20)15-17(23)14-19(21)26(3,4)18-10-6-5-7-11-18/h5-7,10-11,17,19,23H,8-9,12-16H2,1-4H3/t17-,19+,21+,22+/m0/s1 |
| InChIKey | KWNHQULRWXBVQW-RGMHLJPOSA-N |
| XLogP | 4.21 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|