C20H30O3Si — CID 10427755
[(3S,4R,5R,6S)-6-[dimethyl(phenyl)silyl]-5-hydroxy-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl] acetate (PubChem CID 10427755) has the molecular formula C20H30O3Si and a molecular weight of 346.54 g/mol. Its IUPAC name is [(3S,4R,5R,6S)-6-[dimethyl(phenyl)silyl]-5-hydroxy-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl] acetate.
| Compound Name | [(3S,4R,5R,6S)-6-[dimethyl(phenyl)silyl]-5-hydroxy-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl] acetate |
|---|---|
| PubChem CID | 10427755 |
| Molecular Formula | C20H30O3Si |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | [(3S,4R,5R,6S)-6-[dimethyl(phenyl)silyl]-5-hydroxy-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl] acetate |
| SMILES | CC(=O)O[C@H]1CC2C(C)(C)[C@]2([Si](C)(C)c2ccccc2)[C@H](O)[C@H]1C |
| InChI | InChI=1S/C20H30O3Si/c1-13-16(23-14(2)21)12-17-19(3,4)20(17,18(13)22)24(5,6)15-10-8-7-9-11-15/h7-11,13,16-18,22H,12H2,1-6H3/t13-,16-,17?,18+,20+/m0/s1 |
| InChIKey | XUFAGCRBSUHTJW-VOLQKEBCSA-N |
| XLogP | 3.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|