C22H26O3 — CID 101271158
[(2R,3R,4S,6R)-3-methyl-2-phenyl-6-(2-phenylethyl)oxan-4-yl] acetate (PubChem CID 101271158) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is [(2R,3R,4S,6R)-3-methyl-2-phenyl-6-(2-phenylethyl)oxan-4-yl] acetate.
| Compound Name | [(2R,3R,4S,6R)-3-methyl-2-phenyl-6-(2-phenylethyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 101271158 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | [(2R,3R,4S,6R)-3-methyl-2-phenyl-6-(2-phenylethyl)oxan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H](CCc2ccccc2)O[C@@H](c2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C22H26O3/c1-16-21(24-17(2)23)15-20(14-13-18-9-5-3-6-10-18)25-22(16)19-11-7-4-8-12-19/h3-12,16,20-22H,13-15H2,1-2H3/t16-,20-,21+,22-/m1/s1 |
| InChIKey | ZZCMURTZUWEUTK-ZINXYGQCSA-N |
| XLogP | 4.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |